C19H27F3N2O3 — CID 124559663
tert-butyl (3S)-3-methyl-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazine-1-carboxylate (PubChem CID 124559663) has the molecular formula C19H27F3N2O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-methyl-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methyl-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 124559663 |
| Molecular Formula | C19H27F3N2O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | tert-butyl (3S)-3-methyl-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCN1c1ccc([C@](C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H27F3N2O3/c1-13-12-23(16(25)27-17(2,3)4)10-11-24(13)15-8-6-14(7-9-15)18(5,26)19(20,21)22/h6-9,13,26H,10-12H2,1-5H3/t13-,18-/m0/s1 |
| InChIKey | QECFKQYUCQCNKY-UGSOOPFHSA-N |
| XLogP | 3.90 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|