C16H25N4O4+ — CID 156735964
methoxy-[5-[(2S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-2-pyridinyl]-oxoazanium (PubChem CID 156735964) has the molecular formula C16H25N4O4+ and a molecular weight of 337.40 g/mol. Its IUPAC name is methoxy-[5-[(2S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-2-pyridinyl]-oxoazanium.
| Compound Name | methoxy-[5-[(2S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-2-pyridinyl]-oxoazanium |
|---|---|
| PubChem CID | 156735964 |
| Molecular Formula | C16H25N4O4+ |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | methoxy-[5-[(2S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-2-pyridinyl]-oxoazanium |
| SMILES | CO[N+](=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)cn1 |
| InChI | InChI=1S/C16H25N4O4/c1-12-11-18(15(21)24-16(2,3)4)8-9-19(12)13-6-7-14(17-10-13)20(22)23-5/h6-7,10,12H,8-9,11H2,1-5H3/q+1/t12-/m0/s1 |
| InChIKey | QEUKEBDQRDCPCO-LBPRGKRZSA-N |
| XLogP | 2.50 |
| TPSA | 74.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|