C14H19BN4O4 — CID 169205520
CID 169205520 (PubChem CID 169205520) has the molecular formula C14H19BN4O4 and a molecular weight of 318.14 g/mol.
| Compound Name | CID 169205520 |
|---|---|
| PubChem CID | 169205520 |
| Molecular Formula | C14H19BN4O4 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | — |
| SMILES | [B]C1CN(C(=O)OC(C)(C)C)CCN1c1ccc([N+](=O)[O-])nc1 |
| InChI | InChI=1S/C14H19BN4O4/c1-14(2,3)23-13(20)17-6-7-18(11(15)9-17)10-4-5-12(16-8-10)19(21)22/h4-5,8,11H,6-7,9H2,1-3H3 |
| InChIKey | PEWUXRGMQWHBFT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|