C23H33N5O5 — CID 162681796
tert-butyl 2-[1-(6-nitro-3-pyridinyl)piperidine-4-carbonyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 162681796) has the molecular formula C23H33N5O5 and a molecular weight of 459.55 g/mol. Its IUPAC name is tert-butyl 2-[1-(6-nitro-3-pyridinyl)piperidine-4-carbonyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[1-(6-nitro-3-pyridinyl)piperidine-4-carbonyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 162681796 |
| Molecular Formula | C23H33N5O5 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | tert-butyl 2-[1-(6-nitro-3-pyridinyl)piperidine-4-carbonyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(C(=O)C1CCN(c3ccc([N+](=O)[O-])nc3)CC1)C2 |
| InChI | InChI=1S/C23H33N5O5/c1-22(2,3)33-21(30)26-12-8-23(9-13-26)15-27(16-23)20(29)17-6-10-25(11-7-17)18-4-5-19(24-14-18)28(31)32/h4-5,14,17H,6-13,15-16H2,1-3H3 |
| InChIKey | YWBDLGJPVAJPAF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 109.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|