C36H50N8O10 — CID 161410421
tert-butyl 3-(6-amino-3-pyridinyl)-2-oxo-1-oxa-3,9-diazaspiro[4.6]undecane-9-carboxylate;tert-butyl 3-(6-nitro-3-pyridinyl)-2-oxo-1-oxa-3,9-diazaspiro[4.6]undecane-9-carboxylate (PubChem CID 161410421) has the molecular formula C36H50N8O10 and a molecular weight of 754.84 g/mol. Its IUPAC name is tert-butyl 3-(6-amino-3-pyridinyl)-2-oxo-1-oxa-3,9-diazaspiro[4.6]undecane-9-carboxylate;tert-butyl 3-(6-nitro-3-pyridinyl)-2-oxo-1-oxa-3,9-diazaspiro[4.6]undecane-9-carboxylate.
| Compound Name | tert-butyl 3-(6-amino-3-pyridinyl)-2-oxo-1-oxa-3,9-diazaspiro[4.6]undecane-9-carboxylate;tert-butyl 3-(6-nitro-3-pyridinyl)-2-oxo-1-oxa-3,9-diazaspiro[4.6]undecane-9-carboxylate |
|---|---|
| PubChem CID | 161410421 |
| Molecular Formula | C36H50N8O10 |
| Molecular Weight | 754.84 g/mol |
| Exact Mass | 754.36 |
| IUPAC Name | tert-butyl 3-(6-amino-3-pyridinyl)-2-oxo-1-oxa-3,9-diazaspiro[4.6]undecane-9-carboxylate;tert-butyl 3-(6-nitro-3-pyridinyl)-2-oxo-1-oxa-3,9-diazaspiro[4.6]undecane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(CC1)CN(c1ccc(N)nc1)C(=O)O2.CC(C)(C)OC(=O)N1CCCC2(CC1)CN(c1ccc([N+](=O)[O-])nc1)C(=O)O2 |
| InChI | InChI=1S/C18H24N4O6.C18H26N4O4/c1-17(2,3)27-15(23)20-9-4-7-18(8-10-20)12-21(16(24)28-18)13-5-6-14(19-11-13)22(25)26;1-17(2,3)25-15(23)21-9-4-7-18(8-10-21)12-22(16(24)26-18)13-5-6-14(19)20-11-13/h5-6,11H,4,7-10,12H2,1-3H3;5-6,11H,4,7-10,12H2,1-3H3,(H2,19,20) |
| InChIKey | VVJWYUMLCGTYCZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 213.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.84 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|