C16H20N4O5 — CID 67355839
tert-butyl 3-(6-nitro-3-pyridinyl)-2-oxo-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 67355839) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is tert-butyl 3-(6-nitro-3-pyridinyl)-2-oxo-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-(6-nitro-3-pyridinyl)-2-oxo-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 67355839 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | tert-butyl 3-(6-nitro-3-pyridinyl)-2-oxo-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C(=O)N(c1ccc([N+](=O)[O-])nc1)C2 |
| InChI | InChI=1S/C16H20N4O5/c1-16(2,3)25-15(22)19-11-4-6-12(19)14(21)18(9-11)10-5-7-13(17-8-10)20(23)24/h5,7-8,11-12H,4,6,9H2,1-3H3 |
| InChIKey | QHRVCXOXWDSBKY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|