C17H26N2O2 — CID 59853726
tert-butyl 3-methyl-4-(4-methylphenyl)piperazine-1-carboxylate (PubChem CID 59853726) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-(4-methylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-4-(4-methylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59853726 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | tert-butyl 3-methyl-4-(4-methylphenyl)piperazine-1-carboxylate |
| SMILES | Cc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2C)cc1 |
| InChI | InChI=1S/C17H26N2O2/c1-13-6-8-15(9-7-13)19-11-10-18(12-14(19)2)16(20)21-17(3,4)5/h6-9,14H,10-12H2,1-5H3 |
| InChIKey | POKDEARVCJSZJY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|