C19H25FN4O2 — CID 174993163
tert-butyl 4-[3-fluoro-5-(1H-pyrazol-4-yl)phenyl]-3-methylpiperazine-1-carboxylate (PubChem CID 174993163) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is tert-butyl 4-[3-fluoro-5-(1H-pyrazol-4-yl)phenyl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-fluoro-5-(1H-pyrazol-4-yl)phenyl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 174993163 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | tert-butyl 4-[3-fluoro-5-(1H-pyrazol-4-yl)phenyl]-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1c1cc(F)cc(-c2cn[nH]c2)c1 |
| InChI | InChI=1S/C19H25FN4O2/c1-13-12-23(18(25)26-19(2,3)4)5-6-24(13)17-8-14(7-16(20)9-17)15-10-21-22-11-15/h7-11,13H,5-6,12H2,1-4H3,(H,21,22) |
| InChIKey | NRDHZJGHNBPFGD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |