C17H27N3O3 — CID 118555274
tert-butyl (3S)-4-(4-ethoxy-2-pyridinyl)-3-methylpiperazine-1-carboxylate (PubChem CID 118555274) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl (3S)-4-(4-ethoxy-2-pyridinyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(4-ethoxy-2-pyridinyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 118555274 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl (3S)-4-(4-ethoxy-2-pyridinyl)-3-methylpiperazine-1-carboxylate |
| SMILES | CCOc1ccnc(N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-6-22-14-7-8-18-15(11-14)20-10-9-19(12-13(20)2)16(21)23-17(3,4)5/h7-8,11,13H,6,9-10,12H2,1-5H3/t13-/m0/s1 |
| InChIKey | JOTLTTCCHAJYLA-ZDUSSCGKSA-N |
| XLogP | 2.93 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |