C21H34N4O4 — CID 118555257
tert-butyl 3-methyl-4-[4-(2-morpholin-4-ylethoxy)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 118555257) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-[4-(2-morpholin-4-ylethoxy)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-4-[4-(2-morpholin-4-ylethoxy)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118555257 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | tert-butyl 3-methyl-4-[4-(2-morpholin-4-ylethoxy)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1c1cc(OCCN2CCOCC2)ccn1 |
| InChI | InChI=1S/C21H34N4O4/c1-17-16-24(20(26)29-21(2,3)4)7-8-25(17)19-15-18(5-6-22-19)28-14-11-23-9-12-27-13-10-23/h5-6,15,17H,7-14,16H2,1-4H3 |
| InChIKey | UOGPKNYENCKVEQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |