C16H22N4O2 — CID 126849836
tert-butyl (3R)-4-(6-ethynylpyrimidin-4-yl)-3-methylpiperazine-1-carboxylate (PubChem CID 126849836) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is tert-butyl (3R)-4-(6-ethynylpyrimidin-4-yl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-(6-ethynylpyrimidin-4-yl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 126849836 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | tert-butyl (3R)-4-(6-ethynylpyrimidin-4-yl)-3-methylpiperazine-1-carboxylate |
| SMILES | C#Cc1cc(N2CCN(C(=O)OC(C)(C)C)C[C@H]2C)ncn1 |
| InChI | InChI=1S/C16H22N4O2/c1-6-13-9-14(18-11-17-13)20-8-7-19(10-12(20)2)15(21)22-16(3,4)5/h1,9,11-12H,7-8,10H2,2-5H3/t12-/m1/s1 |
| InChIKey | FXIBLUSLGNIWSR-GFCCVEGCSA-N |
| XLogP | 1.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|