C17H26ClN3O2 — CID 167093707
tert-butyl (5R)-4-(6-chloro-2-pyridinyl)-5,6-dimethyl-1,4-diazepane-1-carboxylate (PubChem CID 167093707) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is tert-butyl (5R)-4-(6-chloro-2-pyridinyl)-5,6-dimethyl-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl (5R)-4-(6-chloro-2-pyridinyl)-5,6-dimethyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 167093707 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | tert-butyl (5R)-4-(6-chloro-2-pyridinyl)-5,6-dimethyl-1,4-diazepane-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN(c2cccc(Cl)n2)[C@@H]1C |
| InChI | InChI=1S/C17H26ClN3O2/c1-12-11-20(16(22)23-17(3,4)5)9-10-21(13(12)2)15-8-6-7-14(18)19-15/h6-8,12-13H,9-11H2,1-5H3/t12?,13-/m1/s1 |
| InChIKey | UJPSZMLKXPLYGI-ZGTCLIOFSA-N |
| XLogP | 3.82 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|