C19H30N2O3 — CID 91641735
tert-butyl N-[1-[(2-hydroxy-4,5-dimethylphenyl)methyl]piperidin-3-yl]carbamate (PubChem CID 91641735) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl N-[1-[(2-hydroxy-4,5-dimethylphenyl)methyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2-hydroxy-4,5-dimethylphenyl)methyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 91641735 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | tert-butyl N-[1-[(2-hydroxy-4,5-dimethylphenyl)methyl]piperidin-3-yl]carbamate |
| SMILES | Cc1cc(O)c(CN2CCCC(NC(=O)OC(C)(C)C)C2)cc1C |
| InChI | InChI=1S/C19H30N2O3/c1-13-9-15(17(22)10-14(13)2)11-21-8-6-7-16(12-21)20-18(23)24-19(3,4)5/h9-10,16,22H,6-8,11-12H2,1-5H3,(H,20,23) |
| InChIKey | OEEUGYHNOZCTDD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|