C18H26BrFN2O2 — CID 172913898
tert-butyl N-[(3S)-1-[(2-bromo-5-fluoro-4-methylphenyl)methyl]piperidin-3-yl]carbamate (PubChem CID 172913898) has the molecular formula C18H26BrFN2O2 and a molecular weight of 401.32 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[(2-bromo-5-fluoro-4-methylphenyl)methyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[(2-bromo-5-fluoro-4-methylphenyl)methyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 172913898 |
| Molecular Formula | C18H26BrFN2O2 |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | tert-butyl N-[(3S)-1-[(2-bromo-5-fluoro-4-methylphenyl)methyl]piperidin-3-yl]carbamate |
| SMILES | Cc1cc(Br)c(CN2CCC[C@H](NC(=O)OC(C)(C)C)C2)cc1F |
| InChI | InChI=1S/C18H26BrFN2O2/c1-12-8-15(19)13(9-16(12)20)10-22-7-5-6-14(11-22)21-17(23)24-18(2,3)4/h8-9,14H,5-7,10-11H2,1-4H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | DJRAHQGYQRDMCC-AWEZNQCLSA-N |
| XLogP | 4.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |