C18H24BrFN2O3 — CID 176515927
tert-butyl N-[(3R)-1-[2-(3-bromo-4-fluorophenyl)acetyl]piperidin-3-yl]carbamate (PubChem CID 176515927) has the molecular formula C18H24BrFN2O3 and a molecular weight of 415.30 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[2-(3-bromo-4-fluorophenyl)acetyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[2-(3-bromo-4-fluorophenyl)acetyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 176515927 |
| Molecular Formula | C18H24BrFN2O3 |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | tert-butyl N-[(3R)-1-[2-(3-bromo-4-fluorophenyl)acetyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(C(=O)Cc2ccc(F)c(Br)c2)C1 |
| InChI | InChI=1S/C18H24BrFN2O3/c1-18(2,3)25-17(24)21-13-5-4-8-22(11-13)16(23)10-12-6-7-15(20)14(19)9-12/h6-7,9,13H,4-5,8,10-11H2,1-3H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | DKUKYKFADJTDPO-CYBMUJFWSA-N |
| XLogP | 3.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |