C17H21BrF2N2O3 — CID 172646625
tert-butyl N-[(3R)-1-(3-bromo-4,5-difluorobenzoyl)piperidin-3-yl]carbamate (PubChem CID 172646625) has the molecular formula C17H21BrF2N2O3 and a molecular weight of 419.27 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(3-bromo-4,5-difluorobenzoyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(3-bromo-4,5-difluorobenzoyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 172646625 |
| Molecular Formula | C17H21BrF2N2O3 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | tert-butyl N-[(3R)-1-(3-bromo-4,5-difluorobenzoyl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(C(=O)c2cc(F)c(F)c(Br)c2)C1 |
| InChI | InChI=1S/C17H21BrF2N2O3/c1-17(2,3)25-16(24)21-11-5-4-6-22(9-11)15(23)10-7-12(18)14(20)13(19)8-10/h7-8,11H,4-6,9H2,1-3H3,(H,21,24)/t11-/m1/s1 |
| InChIKey | RYOXCMGCKTVCQH-LLVKDONJSA-N |
| XLogP | 3.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|