C16H20BrIN2O3 — CID 170590095
tert-butyl N-[(3S)-1-(3-bromo-4-iodobenzoyl)pyrrolidin-3-yl]carbamate (PubChem CID 170590095) has the molecular formula C16H20BrIN2O3 and a molecular weight of 495.16 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(3-bromo-4-iodobenzoyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(3-bromo-4-iodobenzoyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 170590095 |
| Molecular Formula | C16H20BrIN2O3 |
| Molecular Weight | 495.16 g/mol |
| Exact Mass | 493.97 |
| IUPAC Name | tert-butyl N-[(3S)-1-(3-bromo-4-iodobenzoyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(C(=O)c2ccc(I)c(Br)c2)C1 |
| InChI | InChI=1S/C16H20BrIN2O3/c1-16(2,3)23-15(22)19-11-6-7-20(9-11)14(21)10-4-5-13(18)12(17)8-10/h4-5,8,11H,6-7,9H2,1-3H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | RGCNYFRGELUDGS-NSHDSACASA-N |
| XLogP | 3.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|