C11H20N2O3 — CID 20716164
tert-butyl N-(1-acetylpyrrolidin-3-yl)carbamate (PubChem CID 20716164) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is tert-butyl N-(1-acetylpyrrolidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-acetylpyrrolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 20716164 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | tert-butyl N-(1-acetylpyrrolidin-3-yl)carbamate |
| SMILES | CC(=O)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H20N2O3/c1-8(14)13-6-5-9(7-13)12-10(15)16-11(2,3)4/h9H,5-7H2,1-4H3,(H,12,15) |
| InChIKey | LCOCMEGQRKOYAP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |