C10H19N2O2- — CID 59130918
tert-butyl N-(1-methanidylpyrrolidin-3-yl)carbamate (PubChem CID 59130918) has the molecular formula C10H19N2O2- and a molecular weight of 199.27 g/mol. Its IUPAC name is tert-butyl N-(1-methanidylpyrrolidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-methanidylpyrrolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 59130918 |
| Molecular Formula | C10H19N2O2- |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.15 |
| IUPAC Name | tert-butyl N-(1-methanidylpyrrolidin-3-yl)carbamate |
| SMILES | [CH2-]N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C10H19N2O2/c1-10(2,3)14-9(13)11-8-5-6-12(4)7-8/h8H,4-7H2,1-3H3,(H,11,13)/q-1 |
| InChIKey | KJWGZZVGCVXMMB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|