C13H26N2O2 — CID 59986888
tert-butyl N-[(3R)-1-tert-butylpyrrolidin-3-yl]carbamate (PubChem CID 59986888) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-tert-butylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-tert-butylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 59986888 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | tert-butyl N-[(3R)-1-tert-butylpyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-12(2,3)15-8-7-10(9-15)14-11(16)17-13(4,5)6/h10H,7-9H2,1-6H3,(H,14,16)/t10-/m1/s1 |
| InChIKey | OKKYWGYWWPLMQF-SNVBAGLBSA-N |
| XLogP | 2.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |