C17H29N3O3 — CID 178183817
tert-butyl N-[(3S)-1-(4-aminobicyclo[2.2.1]heptane-1-carbonyl)pyrrolidin-3-yl]carbamate (PubChem CID 178183817) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(4-aminobicyclo[2.2.1]heptane-1-carbonyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(4-aminobicyclo[2.2.1]heptane-1-carbonyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 178183817 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | tert-butyl N-[(3S)-1-(4-aminobicyclo[2.2.1]heptane-1-carbonyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(C(=O)C23CCC(N)(CC2)C3)C1 |
| InChI | InChI=1S/C17H29N3O3/c1-15(2,3)23-14(22)19-12-4-9-20(10-12)13(21)16-5-7-17(18,11-16)8-6-16/h12H,4-11,18H2,1-3H3,(H,19,22)/t12-,16?,17?/m0/s1 |
| InChIKey | WCQUFAVNDWVYOY-CDEQTRAXSA-N |
| XLogP | 1.77 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |