C10H20N4O2 — CID 95187739
tert-butyl N-[(3S)-1-carbamimidoylpyrrolidin-3-yl]carbamate (PubChem CID 95187739) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-carbamimidoylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-carbamimidoylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 95187739 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | tert-butyl N-[(3S)-1-carbamimidoylpyrrolidin-3-yl]carbamate |
| SMILES | [H]/N=C(\N)N1CC[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C10H20N4O2/c1-10(2,3)16-9(15)13-7-4-5-14(6-7)8(11)12/h7H,4-6H2,1-3H3,(H3,11,12)(H,13,15)/t7-/m0/s1 |
| InChIKey | RCGGLICOFABLHP-ZETCQYMHSA-N |
| XLogP | 0.48 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|