C18H31N3O3 — CID 178203068
tert-butyl N-[1-(4-aminobicyclo[2.2.1]heptane-1-carbonyl)piperidin-4-yl]carbamate (PubChem CID 178203068) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[1-(4-aminobicyclo[2.2.1]heptane-1-carbonyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-aminobicyclo[2.2.1]heptane-1-carbonyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 178203068 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | tert-butyl N-[1-(4-aminobicyclo[2.2.1]heptane-1-carbonyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)C23CCC(N)(CC2)C3)CC1 |
| InChI | InChI=1S/C18H31N3O3/c1-16(2,3)24-15(23)20-13-4-10-21(11-5-13)14(22)17-6-8-18(19,12-17)9-7-17/h13H,4-12,19H2,1-3H3,(H,20,23) |
| InChIKey | PTTTXQDKTATEIN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |