C13H23ClN2O3 — CID 124703982
tert-butyl N-[1-(3-chloropropanoyl)piperidin-4-yl]carbamate (PubChem CID 124703982) has the molecular formula C13H23ClN2O3 and a molecular weight of 290.79 g/mol. Its IUPAC name is tert-butyl N-[1-(3-chloropropanoyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-chloropropanoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 124703982 |
| Molecular Formula | C13H23ClN2O3 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | tert-butyl N-[1-(3-chloropropanoyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)CCCl)CC1 |
| InChI | InChI=1S/C13H23ClN2O3/c1-13(2,3)19-12(18)15-10-5-8-16(9-6-10)11(17)4-7-14/h10H,4-9H2,1-3H3,(H,15,18) |
| InChIKey | ZZCMAHZCSZSHKH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|