C12H20N2O4 — CID 108567119
methyl N-[1-(4-oxopentanoyl)piperidin-4-yl]carbamate (PubChem CID 108567119) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl N-[1-(4-oxopentanoyl)piperidin-4-yl]carbamate.
| Compound Name | methyl N-[1-(4-oxopentanoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108567119 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | methyl N-[1-(4-oxopentanoyl)piperidin-4-yl]carbamate |
| SMILES | COC(=O)NC1CCN(C(=O)CCC(C)=O)CC1 |
| InChI | InChI=1S/C12H20N2O4/c1-9(15)3-4-11(16)14-7-5-10(6-8-14)13-12(17)18-2/h10H,3-8H2,1-2H3,(H,13,17) |
| InChIKey | IMQLIGXEFGGKBK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |