C14H22N2O4 — CID 108567125
prop-2-enyl N-[1-(4-oxopentanoyl)piperidin-4-yl]carbamate (PubChem CID 108567125) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is prop-2-enyl N-[1-(4-oxopentanoyl)piperidin-4-yl]carbamate.
| Compound Name | prop-2-enyl N-[1-(4-oxopentanoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108567125 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | prop-2-enyl N-[1-(4-oxopentanoyl)piperidin-4-yl]carbamate |
| SMILES | C=CCOC(=O)NC1CCN(C(=O)CCC(C)=O)CC1 |
| InChI | InChI=1S/C14H22N2O4/c1-3-10-20-14(19)15-12-6-8-16(9-7-12)13(18)5-4-11(2)17/h3,12H,1,4-10H2,2H3,(H,15,19) |
| InChIKey | DNAJAKDWDDWSEI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|