About prop-2-enyl N-cyclohexylcarbamate
prop-2-enyl N-cyclohexylcarbamate (PubChem CID 11126927) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is prop-2-enyl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | prop-2-enyl N-cyclohexylcarbamate |
| PubChem CID | 11126927 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | prop-2-enyl N-cyclohexylcarbamate |
| SMILES | C=CCOC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C10H17NO2/c1-2-8-13-10(12)11-9-6-4-3-5-7-9/h2,9H,1,3-8H2,(H,11,12) |
| InChIKey | XCLLTFIVJLOSRS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N-cyclohexylcarbamate?
The IUPAC name of prop-2-enyl N-cyclohexylcarbamate (CID 11126927) is prop-2-enyl N-cyclohexylcarbamate.
What is the SMILES notation for prop-2-enyl N-cyclohexylcarbamate?
The canonical SMILES for prop-2-enyl N-cyclohexylcarbamate is C=CCOC(=O)NC1CCCCC1.
What is the InChIKey of prop-2-enyl N-cyclohexylcarbamate?
The InChIKey is XCLLTFIVJLOSRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-2-8-13-10(12)11-9-6-4-3-5-7-9/h2,9H,1,3-8H2,(H,11,12).
What are the key properties of prop-2-enyl N-cyclohexylcarbamate?
prop-2-enyl N-cyclohexylcarbamate has a molecular weight of 183.25 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N-cyclohexylcarbamate is sourced from PubChem (CID 11126927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).