About propan-2-yl N-cyclooctylcarbamate
propan-2-yl N-cyclooctylcarbamate (PubChem CID 116653938) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is propan-2-yl N-cyclooctylcarbamate.
Molecular Properties
| Compound Name | propan-2-yl N-cyclooctylcarbamate |
| PubChem CID | 116653938 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | propan-2-yl N-cyclooctylcarbamate |
| SMILES | CC(C)OC(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C12H23NO2/c1-10(2)15-12(14)13-11-8-6-4-3-5-7-9-11/h10-11H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | BLHONLYKYGWXML-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-yl N-cyclooctylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-cyclooctylcarbamate?
The IUPAC name of propan-2-yl N-cyclooctylcarbamate (CID 116653938) is propan-2-yl N-cyclooctylcarbamate.
What is the SMILES notation for propan-2-yl N-cyclooctylcarbamate?
The canonical SMILES for propan-2-yl N-cyclooctylcarbamate is CC(C)OC(=O)NC1CCCCCCC1.
What is the InChIKey of propan-2-yl N-cyclooctylcarbamate?
The InChIKey is BLHONLYKYGWXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-10(2)15-12(14)13-11-8-6-4-3-5-7-9-11/h10-11H,3-9H2,1-2H3,(H,13,14).
What are the key properties of propan-2-yl N-cyclooctylcarbamate?
propan-2-yl N-cyclooctylcarbamate has a molecular weight of 213.32 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-cyclooctylcarbamate is sourced from PubChem (CID 116653938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).