About 1-bromopropan-2-yl N-cyclohexylcarbamate
1-bromopropan-2-yl N-cyclohexylcarbamate (PubChem CID 103970804) has the molecular formula C10H18BrNO2
and a molecular weight of 264.16 g/mol. Its IUPAC name is 1-bromopropan-2-yl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | 1-bromopropan-2-yl N-cyclohexylcarbamate |
| PubChem CID | 103970804 |
| Molecular Formula | C10H18BrNO2 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-bromopropan-2-yl N-cyclohexylcarbamate |
| SMILES | CC(CBr)OC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C10H18BrNO2/c1-8(7-11)14-10(13)12-9-5-3-2-4-6-9/h8-9H,2-7H2,1H3,(H,12,13) |
| InChIKey | GKUDBUHGHKGTBI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopropan-2-yl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopropan-2-yl N-cyclohexylcarbamate?
The IUPAC name of 1-bromopropan-2-yl N-cyclohexylcarbamate (CID 103970804) is 1-bromopropan-2-yl N-cyclohexylcarbamate.
What is the SMILES notation for 1-bromopropan-2-yl N-cyclohexylcarbamate?
The canonical SMILES for 1-bromopropan-2-yl N-cyclohexylcarbamate is CC(CBr)OC(=O)NC1CCCCC1.
What is the InChIKey of 1-bromopropan-2-yl N-cyclohexylcarbamate?
The InChIKey is GKUDBUHGHKGTBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18BrNO2/c1-8(7-11)14-10(13)12-9-5-3-2-4-6-9/h8-9H,2-7H2,1H3,(H,12,13).
What are the key properties of 1-bromopropan-2-yl N-cyclohexylcarbamate?
1-bromopropan-2-yl N-cyclohexylcarbamate has a molecular weight of 264.16 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopropan-2-yl N-cyclohexylcarbamate is sourced from PubChem (CID 103970804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).