C26H50N4O5Sn — CID 70601054
1-[(propanoylamino)-[2-[(3-trimethylstannylcyclohexyl)carbamoyloxy]propyl]amino]propan-2-yl N-cyclohexylcarbamate (PubChem CID 70601054) has the molecular formula C26H50N4O5Sn and a molecular weight of 617.42 g/mol. Its IUPAC name is 1-[(propanoylamino)-[2-[(3-trimethylstannylcyclohexyl)carbamoyloxy]propyl]amino]propan-2-yl N-cyclohexylcarbamate.
| Compound Name | 1-[(propanoylamino)-[2-[(3-trimethylstannylcyclohexyl)carbamoyloxy]propyl]amino]propan-2-yl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 70601054 |
| Molecular Formula | C26H50N4O5Sn |
| Molecular Weight | 617.42 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 1-[(propanoylamino)-[2-[(3-trimethylstannylcyclohexyl)carbamoyloxy]propyl]amino]propan-2-yl N-cyclohexylcarbamate |
| SMILES | CCC(=O)NN(CC(C)OC(=O)NC1CCCCC1)CC(C)OC(=O)NC1CCCC([Sn](C)(C)C)C1 |
| InChI | InChI=1S/C23H41N4O5.3CH3.Sn/c1-4-21(28)26-27(15-17(2)31-22(29)24-19-11-7-5-8-12-19)16-18(3)32-23(30)25-20-13-9-6-10-14-20;;;;/h7,17-20H,4-6,8-16H2,1-3H3,(H,24,29)(H,25,30)(H,26,28);3*1H3; |
| InChIKey | LWSGNHJUEQJCSC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|