About propan-2-ylcarbamoyl N-cyclohexylcarbamate
propan-2-ylcarbamoyl N-cyclohexylcarbamate (PubChem CID 154236264) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is propan-2-ylcarbamoyl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | propan-2-ylcarbamoyl N-cyclohexylcarbamate |
| PubChem CID | 154236264 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | propan-2-ylcarbamoyl N-cyclohexylcarbamate |
| SMILES | CC(C)NC(=O)OC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H20N2O3/c1-8(2)12-10(14)16-11(15)13-9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | GYTDYFFRRMNGJB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ylcarbamoyl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylcarbamoyl N-cyclohexylcarbamate?
The IUPAC name of propan-2-ylcarbamoyl N-cyclohexylcarbamate (CID 154236264) is propan-2-ylcarbamoyl N-cyclohexylcarbamate.
What is the SMILES notation for propan-2-ylcarbamoyl N-cyclohexylcarbamate?
The canonical SMILES for propan-2-ylcarbamoyl N-cyclohexylcarbamate is CC(C)NC(=O)OC(=O)NC1CCCCC1.
What is the InChIKey of propan-2-ylcarbamoyl N-cyclohexylcarbamate?
The InChIKey is GYTDYFFRRMNGJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-8(2)12-10(14)16-11(15)13-9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3,(H,12,14)(H,13,15).
What are the key properties of propan-2-ylcarbamoyl N-cyclohexylcarbamate?
propan-2-ylcarbamoyl N-cyclohexylcarbamate has a molecular weight of 228.29 g/mol, XLogP of 2.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylcarbamoyl N-cyclohexylcarbamate is sourced from PubChem (CID 154236264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).