C13H27N3OSSn — CID 88790723
1-(propanoylamino)-3-(3-trimethylstannylcyclohexyl)thiourea (PubChem CID 88790723) has the molecular formula C13H27N3OSSn and a molecular weight of 392.16 g/mol. Its IUPAC name is 1-(propanoylamino)-3-(3-trimethylstannylcyclohexyl)thiourea.
| Compound Name | 1-(propanoylamino)-3-(3-trimethylstannylcyclohexyl)thiourea |
|---|---|
| PubChem CID | 88790723 |
| Molecular Formula | C13H27N3OSSn |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 1-(propanoylamino)-3-(3-trimethylstannylcyclohexyl)thiourea |
| SMILES | CCC(=O)NNC(=S)NC1CCCC([Sn](C)(C)C)C1 |
| InChI | InChI=1S/C10H18N3OS.3CH3.Sn/c1-2-9(14)12-13-10(15)11-8-6-4-3-5-7-8;;;;/h4,8H,2-3,5-7H2,1H3,(H,12,14)(H2,11,13,15);3*1H3; |
| InChIKey | WSOGQBGWFBGJCA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|