About 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea
1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea (PubChem CID 4684324) has the molecular formula C15H23N5OS2
and a molecular weight of 353.52 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea |
| PubChem CID | 4684324 |
| Molecular Formula | C15H23N5OS2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea |
| SMILES | Cc1cc(C)nc(SCC(=O)NNC(=S)NC2CCCCC2)n1 |
| InChI | InChI=1S/C15H23N5OS2/c1-10-8-11(2)17-15(16-10)23-9-13(21)19-20-14(22)18-12-6-4-3-5-7-12/h8,12H,3-7,9H2,1-2H3,(H,19,21)(H2,18,20,22) |
| InChIKey | RNYDREZYJNJNMQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea?
The IUPAC name of 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea (CID 4684324) is 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea.
What is the SMILES notation for 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea?
The canonical SMILES for 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea is Cc1cc(C)nc(SCC(=O)NNC(=S)NC2CCCCC2)n1.
What is the InChIKey of 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea?
The InChIKey is RNYDREZYJNJNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N5OS2/c1-10-8-11(2)17-15(16-10)23-9-13(21)19-20-14(22)18-12-6-4-3-5-7-12/h8,12H,3-7,9H2,1-2H3,(H,19,21)(H2,18,20,22).
What are the key properties of 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea?
1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea has a molecular weight of 353.52 g/mol, XLogP of 2.01, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea is sourced from PubChem (CID 4684324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).