C15H23N5OS2 — CID 4684324
1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea (PubChem CID 4684324) has the molecular formula C15H23N5OS2 and a molecular weight of 353.52 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea.
| Compound Name | 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea |
|---|---|
| PubChem CID | 4684324 |
| Molecular Formula | C15H23N5OS2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-cyclohexyl-3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]thiourea |
| SMILES | Cc1cc(C)nc(SCC(=O)NNC(=S)NC2CCCCC2)n1 |
| InChI | InChI=1S/C15H23N5OS2/c1-10-8-11(2)17-15(16-10)23-9-13(21)19-20-14(22)18-12-6-4-3-5-7-12/h8,12H,3-7,9H2,1-2H3,(H,19,21)(H2,18,20,22) |
| InChIKey | RNYDREZYJNJNMQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|