C15H20ClN3OS2 — CID 3344808
1-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-3-cyclohexylthiourea (PubChem CID 3344808) has the molecular formula C15H20ClN3OS2 and a molecular weight of 357.93 g/mol. Its IUPAC name is 1-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-3-cyclohexylthiourea.
| Compound Name | 1-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 3344808 |
| Molecular Formula | C15H20ClN3OS2 |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 1-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-3-cyclohexylthiourea |
| SMILES | O=C(CSc1ccc(Cl)cc1)NNC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C15H20ClN3OS2/c16-11-6-8-13(9-7-11)22-10-14(20)18-19-15(21)17-12-4-2-1-3-5-12/h6-9,12H,1-5,10H2,(H,18,20)(H2,17,19,21) |
| InChIKey | HYBBLOBPGSJGAE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|