C15H19ClFNOS — CID 29479561
2-(3-chloro-4-fluorophenyl)sulfanyl-N-cycloheptylacetamide (PubChem CID 29479561) has the molecular formula C15H19ClFNOS and a molecular weight of 315.84 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)sulfanyl-N-cycloheptylacetamide.
| Compound Name | 2-(3-chloro-4-fluorophenyl)sulfanyl-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 29479561 |
| Molecular Formula | C15H19ClFNOS |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)sulfanyl-N-cycloheptylacetamide |
| SMILES | O=C(CSc1ccc(F)c(Cl)c1)NC1CCCCCC1 |
| InChI | InChI=1S/C15H19ClFNOS/c16-13-9-12(7-8-14(13)17)20-10-15(19)18-11-5-3-1-2-4-6-11/h7-9,11H,1-6,10H2,(H,18,19) |
| InChIKey | DQVWDRDSBRFFSM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |