C13H17ClN4S2 — CID 971925
1-(4-chlorophenyl)-3-(cyclopentylcarbamothioylamino)thiourea (PubChem CID 971925) has the molecular formula C13H17ClN4S2 and a molecular weight of 328.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(cyclopentylcarbamothioylamino)thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-(cyclopentylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 971925 |
| Molecular Formula | C13H17ClN4S2 |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(cyclopentylcarbamothioylamino)thiourea |
| SMILES | S=C(NNC(=S)NC1CCCC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN4S2/c14-9-5-7-11(8-6-9)16-13(20)18-17-12(19)15-10-3-1-2-4-10/h5-8,10H,1-4H2,(H2,15,17,19)(H2,16,18,20) |
| InChIKey | ALGTULSVIPDMMG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|