C20H28ClN3S — CID 3218010
1-(4-chlorophenyl)-3-(9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea (PubChem CID 3218010) has the molecular formula C20H28ClN3S and a molecular weight of 377.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-(9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea |
|---|---|
| PubChem CID | 3218010 |
| Molecular Formula | C20H28ClN3S |
| Molecular Weight | 377.99 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea |
| SMILES | S=C(Nc1ccc(Cl)cc1)NC1CC2CCCC(C1)N2C1CCCC1 |
| InChI | InChI=1S/C20H28ClN3S/c21-14-8-10-15(11-9-14)22-20(25)23-16-12-18-6-3-7-19(13-16)24(18)17-4-1-2-5-17/h8-11,16-19H,1-7,12-13H2,(H2,22,23,25) |
| InChIKey | XCPZQPKXBWLDQZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.99 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|