C20H28ClN3S — CID 1461586
1-(3-chlorophenyl)-3-[(1R,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea (PubChem CID 1461586) has the molecular formula C20H28ClN3S and a molecular weight of 377.99 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1R,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1R,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
|---|---|
| PubChem CID | 1461586 |
| Molecular Formula | C20H28ClN3S |
| Molecular Weight | 377.99 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1R,5R)-9-cyclopentyl-9-azabicyclo[3.3.1]nonan-3-yl]thiourea |
| SMILES | S=C(Nc1cccc(Cl)c1)NC1C[C@H]2CCC[C@H](C1)N2C1CCCC1 |
| InChI | InChI=1S/C20H28ClN3S/c21-14-5-3-6-15(11-14)22-20(25)23-16-12-18-9-4-10-19(13-16)24(18)17-7-1-2-8-17/h3,5-6,11,16-19H,1-2,4,7-10,12-13H2,(H2,22,23,25)/t18-,19-/m1/s1 |
| InChIKey | BREACPWXLAMJQV-RTBURBONSA-N |
| XLogP | 4.95 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.99 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|