C17H22ClN3S — CID 43813844
1-(4-chlorophenyl)-3-(8-cyclopropyl-8-azabicyclo[3.2.1]octan-3-yl)thiourea (PubChem CID 43813844) has the molecular formula C17H22ClN3S and a molecular weight of 335.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(8-cyclopropyl-8-azabicyclo[3.2.1]octan-3-yl)thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-(8-cyclopropyl-8-azabicyclo[3.2.1]octan-3-yl)thiourea |
|---|---|
| PubChem CID | 43813844 |
| Molecular Formula | C17H22ClN3S |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(8-cyclopropyl-8-azabicyclo[3.2.1]octan-3-yl)thiourea |
| SMILES | S=C(Nc1ccc(Cl)cc1)NC1CC2CCC(C1)N2C1CC1 |
| InChI | InChI=1S/C17H22ClN3S/c18-11-1-3-12(4-2-11)19-17(22)20-13-9-15-7-8-16(10-13)21(15)14-5-6-14/h1-4,13-16H,5-10H2,(H2,19,20,22) |
| InChIKey | VJJQGYZXFRWUFV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|