C21H23F2N3S — CID 1461031
1-(4-fluorophenyl)-3-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]thiourea (PubChem CID 1461031) has the molecular formula C21H23F2N3S and a molecular weight of 387.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]thiourea |
|---|---|
| PubChem CID | 1461031 |
| Molecular Formula | C21H23F2N3S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(1R,5S)-8-[(4-fluorophenyl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]thiourea |
| SMILES | Fc1ccc(CN2[C@@H]3CC[C@H]2CC(NC(=S)Nc2ccc(F)cc2)C3)cc1 |
| InChI | InChI=1S/C21H23F2N3S/c22-15-3-1-14(2-4-15)13-26-19-9-10-20(26)12-18(11-19)25-21(27)24-17-7-5-16(23)6-8-17/h1-8,18-20H,9-13H2,(H2,24,25,27)/t18?,19-,20+ |
| InChIKey | ISHRASLPQNAHAW-IHWFROFDSA-N |
| XLogP | 4.45 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|