C23H28FN3S — CID 43813924
1-[9-[(4-fluorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2-methylphenyl)thiourea (PubChem CID 43813924) has the molecular formula C23H28FN3S and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-[9-[(4-fluorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[9-[(4-fluorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 43813924 |
| Molecular Formula | C23H28FN3S |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-[9-[(4-fluorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)NC1CC2CCCC(C1)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H28FN3S/c1-16-5-2-3-8-22(16)26-23(28)25-19-13-20-6-4-7-21(14-19)27(20)15-17-9-11-18(24)12-10-17/h2-3,5,8-12,19-21H,4,6-7,13-15H2,1H3,(H2,25,26,28) |
| InChIKey | ZNAUKODTZWVNAR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|