C22H27N3O — CID 98109906
1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylphenyl)urea (PubChem CID 98109906) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 98109906 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NC1C[C@H]2CC[C@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C22H27N3O/c1-16-7-5-6-10-21(16)24-22(26)23-18-13-19-11-12-20(14-18)25(19)15-17-8-3-2-4-9-17/h2-10,18-20H,11-15H2,1H3,(H2,23,24,26)/t19-,20-/m1/s1 |
| InChIKey | UOYRWPIMYBCOKG-WOJBJXKFSA-N |
| XLogP | 4.31 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |