C21H23F2N3O — CID 7402590
1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2,4-difluorophenyl)urea (PubChem CID 7402590) has the molecular formula C21H23F2N3O and a molecular weight of 371.43 g/mol. Its IUPAC name is 1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 7402590 |
| Molecular Formula | C21H23F2N3O |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[(1R,5R)-8-benzyl-8-azabicyclo[3.2.1]octan-3-yl]-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)NC1C[C@H]2CC[C@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C21H23F2N3O/c22-15-6-9-20(19(23)10-15)25-21(27)24-16-11-17-7-8-18(12-16)26(17)13-14-4-2-1-3-5-14/h1-6,9-10,16-18H,7-8,11-13H2,(H2,24,25,27)/t17-,18-/m1/s1 |
| InChIKey | XFBLGUFMDIBXAP-QZTJIDSGSA-N |
| XLogP | 4.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |