C21H24F2N3O+ — CID 11902223
1-[(1R,5S)-8-benzyl-8-azoniabicyclo[3.2.1]octan-3-yl]-3-(2,4-difluorophenyl)urea (PubChem CID 11902223) has the molecular formula C21H24F2N3O+ and a molecular weight of 372.44 g/mol. Its IUPAC name is 1-[(1R,5S)-8-benzyl-8-azoniabicyclo[3.2.1]octan-3-yl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[(1R,5S)-8-benzyl-8-azoniabicyclo[3.2.1]octan-3-yl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 11902223 |
| Molecular Formula | C21H24F2N3O+ |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-[(1R,5S)-8-benzyl-8-azoniabicyclo[3.2.1]octan-3-yl]-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)NC1C[C@H]2CC[C@@H](C1)[NH+]2Cc1ccccc1 |
| InChI | InChI=1S/C21H23F2N3O/c22-15-6-9-20(19(23)10-15)25-21(27)24-16-11-17-7-8-18(12-16)26(17)13-14-4-2-1-3-5-14/h1-6,9-10,16-18H,7-8,11-13H2,(H2,24,25,27)/p+1/t16?,17-,18+ |
| InChIKey | XFBLGUFMDIBXAP-AYHJJNSGSA-O |
| XLogP | 2.86 |
| TPSA | 45.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |