C19H19F2N3O2 — CID 47093309
N-cyclopropyl-2-[(2,4-difluorophenyl)carbamoylamino]-3-phenylpropanamide (PubChem CID 47093309) has the molecular formula C19H19F2N3O2 and a molecular weight of 359.38 g/mol. Its IUPAC name is N-cyclopropyl-2-[(2,4-difluorophenyl)carbamoylamino]-3-phenylpropanamide.
| Compound Name | N-cyclopropyl-2-[(2,4-difluorophenyl)carbamoylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 47093309 |
| Molecular Formula | C19H19F2N3O2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-cyclopropyl-2-[(2,4-difluorophenyl)carbamoylamino]-3-phenylpropanamide |
| SMILES | O=C(Nc1ccc(F)cc1F)NC(Cc1ccccc1)C(=O)NC1CC1 |
| InChI | InChI=1S/C19H19F2N3O2/c20-13-6-9-16(15(21)11-13)23-19(26)24-17(18(25)22-14-7-8-14)10-12-4-2-1-3-5-12/h1-6,9,11,14,17H,7-8,10H2,(H,22,25)(H2,23,24,26) |
| InChIKey | UFAGCNWWVIYAQY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |