C21H21N3O2 — CID 95342005
(2R)-N-cyclopropyl-2-[(3-ethynylphenyl)carbamoylamino]-3-phenylpropanamide (PubChem CID 95342005) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-[(3-ethynylphenyl)carbamoylamino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclopropyl-2-[(3-ethynylphenyl)carbamoylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 95342005 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (2R)-N-cyclopropyl-2-[(3-ethynylphenyl)carbamoylamino]-3-phenylpropanamide |
| SMILES | C#Cc1cccc(NC(=O)N[C@H](Cc2ccccc2)C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C21H21N3O2/c1-2-15-9-6-10-18(13-15)23-21(26)24-19(20(25)22-17-11-12-17)14-16-7-4-3-5-8-16/h1,3-10,13,17,19H,11-12,14H2,(H,22,25)(H2,23,24,26)/t19-/m1/s1 |
| InChIKey | LPIIENICTREXAC-LJQANCHMSA-N |
| XLogP | 2.68 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|