C14H14N2O3 — CID 62697749
2-cyclopropyl-2-[(3-ethynylphenyl)carbamoylamino]acetic acid (PubChem CID 62697749) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(3-ethynylphenyl)carbamoylamino]acetic acid.
| Compound Name | 2-cyclopropyl-2-[(3-ethynylphenyl)carbamoylamino]acetic acid |
|---|---|
| PubChem CID | 62697749 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-cyclopropyl-2-[(3-ethynylphenyl)carbamoylamino]acetic acid |
| SMILES | C#Cc1cccc(NC(=O)NC(C(=O)O)C2CC2)c1 |
| InChI | InChI=1S/C14H14N2O3/c1-2-9-4-3-5-11(8-9)15-14(19)16-12(13(17)18)10-6-7-10/h1,3-5,8,10,12H,6-7H2,(H,17,18)(H2,15,16,19) |
| InChIKey | FLIUVUODVVCIHO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|