C19H21F2N3O — CID 972217
1-(1-benzylpiperidin-4-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 972217) has the molecular formula C19H21F2N3O and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 972217 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H21F2N3O/c20-15-6-7-18(17(21)12-15)23-19(25)22-16-8-10-24(11-9-16)13-14-4-2-1-3-5-14/h1-7,12,16H,8-11,13H2,(H2,22,23,25) |
| InChIKey | GDKMUTNZPMNMIY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |