C20H23F2N3O2 — CID 87008877
1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-(2-methoxyphenyl)urea (PubChem CID 87008877) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 87008877 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NC1CCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H23F2N3O2/c1-27-19-5-3-2-4-18(19)24-20(26)23-15-8-10-25(11-9-15)13-14-6-7-16(21)17(22)12-14/h2-7,12,15H,8-11,13H2,1H3,(H2,23,24,26) |
| InChIKey | KBBUNRHHJBJXOI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |