C24H32FN3O2 — CID 55909734
1-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-3-(4-phenylbutan-2-yl)urea (PubChem CID 55909734) has the molecular formula C24H32FN3O2 and a molecular weight of 413.54 g/mol. Its IUPAC name is 1-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-3-(4-phenylbutan-2-yl)urea.
| Compound Name | 1-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-3-(4-phenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 55909734 |
| Molecular Formula | C24H32FN3O2 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 1-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-3-(4-phenylbutan-2-yl)urea |
| SMILES | COc1ccc(CN2CCC(NC(=O)NC(C)CCc3ccccc3)CC2)cc1F |
| InChI | InChI=1S/C24H32FN3O2/c1-18(8-9-19-6-4-3-5-7-19)26-24(29)27-21-12-14-28(15-13-21)17-20-10-11-23(30-2)22(25)16-20/h3-7,10-11,16,18,21H,8-9,12-15,17H2,1-2H3,(H2,26,27,29) |
| InChIKey | BCLNCBUAFGILAQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |